C20H22N2O4 — CID 69381398
4-[3-[3-(1,3-benzoxazol-2-yl)propylamino]propoxy]benzoic acid (PubChem CID 69381398) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-[3-[3-(1,3-benzoxazol-2-yl)propylamino]propoxy]benzoic acid.
| Compound Name | 4-[3-[3-(1,3-benzoxazol-2-yl)propylamino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 69381398 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[3-[3-(1,3-benzoxazol-2-yl)propylamino]propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCNCCCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c23-20(24)15-8-10-16(11-9-15)25-14-4-13-21-12-3-7-19-22-17-5-1-2-6-18(17)26-19/h1-2,5-6,8-11,21H,3-4,7,12-14H2,(H,23,24) |
| InChIKey | GUHORTOHUHJZFD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|