C16H16N2O2 — CID 68835192
N-(1,3-benzoxazol-2-ylmethyl)-2-phenoxyethanamine (PubChem CID 68835192) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(1,3-benzoxazol-2-ylmethyl)-2-phenoxyethanamine.
| Compound Name | N-(1,3-benzoxazol-2-ylmethyl)-2-phenoxyethanamine |
|---|---|
| PubChem CID | 68835192 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(1,3-benzoxazol-2-ylmethyl)-2-phenoxyethanamine |
| SMILES | c1ccc(OCCNCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-2-6-13(7-3-1)19-11-10-17-12-16-18-14-8-4-5-9-15(14)20-16/h1-9,17H,10-12H2 |
| InChIKey | VYBNXVCVHZNIPY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|