C33H37N3O5 — CID 70169603
3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[N-(cycloheptanecarbonyl)anilino]propanoic acid (PubChem CID 70169603) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[N-(cycloheptanecarbonyl)anilino]propanoic acid.
| Compound Name | 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[N-(cycloheptanecarbonyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 70169603 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[N-(cycloheptanecarbonyl)anilino]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(OCCNCc2nc3ccccc3o2)cc1)N(C(=O)C1CCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C33H37N3O5/c37-32(25-10-4-1-2-5-11-25)36(26-12-6-3-7-13-26)29(33(38)39)22-24-16-18-27(19-17-24)40-21-20-34-23-31-35-28-14-8-9-15-30(28)41-31/h3,6-9,12-19,25,29,34H,1-2,4-5,10-11,20-23H2,(H,38,39) |
| InChIKey | GLKJTEYVNXOEDK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|