C31H29N3O5S — CID 54163444
methyl 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[(3-benzoylthiophen-2-yl)amino]propanoate (PubChem CID 54163444) has the molecular formula C31H29N3O5S and a molecular weight of 555.66 g/mol. Its IUPAC name is methyl 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[(3-benzoylthiophen-2-yl)amino]propanoate.
| Compound Name | methyl 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[(3-benzoylthiophen-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 54163444 |
| Molecular Formula | C31H29N3O5S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | methyl 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[(3-benzoylthiophen-2-yl)amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCNCc2nc3ccccc3o2)cc1)Nc1sccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C31H29N3O5S/c1-37-31(36)26(34-30-24(15-18-40-30)29(35)22-7-3-2-4-8-22)19-21-11-13-23(14-12-21)38-17-16-32-20-28-33-25-9-5-6-10-27(25)39-28/h2-15,18,26,32,34H,16-17,19-20H2,1H3 |
| InChIKey | OQACFEXEAHBOQG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|