C20H21N3O4S — CID 69170877
(2R)-2-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 69170877) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is (2R)-2-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R)-2-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 69170877 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (2R)-2-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CS[C@H](c2ccc(OCCNCc3nc4ccccc4o3)cc2)N1 |
| InChI | InChI=1S/C20H21N3O4S/c24-20(25)16-12-28-19(23-16)13-5-7-14(8-6-13)26-10-9-21-11-18-22-15-3-1-2-4-17(15)27-18/h1-8,16,19,21,23H,9-12H2,(H,24,25)/t16?,19-/m1/s1 |
| InChIKey | ADAFHIZIFXUWMW-LRTDYKAYSA-N |
| XLogP | 2.78 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|