C11H14N2O4S — CID 86637355
2-(1,3-benzoxazol-2-ylmethylamino)ethyl methanesulfonate (PubChem CID 86637355) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylmethylamino)ethyl methanesulfonate.
| Compound Name | 2-(1,3-benzoxazol-2-ylmethylamino)ethyl methanesulfonate |
|---|---|
| PubChem CID | 86637355 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylmethylamino)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCNCc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H14N2O4S/c1-18(14,15)16-7-6-12-8-11-13-9-4-2-3-5-10(9)17-11/h2-5,12H,6-8H2,1H3 |
| InChIKey | PHGLCKJLINNWDQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|