C17H18N2O3S — CID 110711884
N-[2-(1,3-benzoxazol-2-yl)ethyl]-2-phenylethanesulfonamide (PubChem CID 110711884) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-yl)ethyl]-2-phenylethanesulfonamide.
| Compound Name | N-[2-(1,3-benzoxazol-2-yl)ethyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 110711884 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-yl)ethyl]-2-phenylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C17H18N2O3S/c20-23(21,13-11-14-6-2-1-3-7-14)18-12-10-17-19-15-8-4-5-9-16(15)22-17/h1-9,18H,10-13H2 |
| InChIKey | NQJQURKCFVKRGO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |