C11H12N2O2 — CID 87717717
N-[3-(1,3-benzoxazol-2-yl)propyl]formamide (PubChem CID 87717717) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)propyl]formamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)propyl]formamide |
|---|---|
| PubChem CID | 87717717 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)propyl]formamide |
| SMILES | O=CNCCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H12N2O2/c14-8-12-7-3-6-11-13-9-4-1-2-5-10(9)15-11/h1-2,4-5,8H,3,6-7H2,(H,12,14) |
| InChIKey | WQPZIVFPCXGRPJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|