C11H12N2O3 — CID 174418719
amino 4-(1,3-benzoxazol-2-yl)butanoate (PubChem CID 174418719) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is amino 4-(1,3-benzoxazol-2-yl)butanoate.
| Compound Name | amino 4-(1,3-benzoxazol-2-yl)butanoate |
|---|---|
| PubChem CID | 174418719 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | amino 4-(1,3-benzoxazol-2-yl)butanoate |
| SMILES | NOC(=O)CCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H12N2O3/c12-16-11(14)7-3-6-10-13-8-4-1-2-5-9(8)15-10/h1-2,4-5H,3,6-7,12H2 |
| InChIKey | SJPBLGABOSWYEW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|