C19H19ClN2O3 — CID 100511008
4-(1,3-benzoxazol-2-yl)-N-[2-(2-chlorophenoxy)ethyl]butanamide (PubChem CID 100511008) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-[2-(2-chlorophenoxy)ethyl]butanamide.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-[2-(2-chlorophenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 100511008 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-[2-(2-chlorophenoxy)ethyl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2o1)NCCOc1ccccc1Cl |
| InChI | InChI=1S/C19H19ClN2O3/c20-14-6-1-3-8-16(14)24-13-12-21-18(23)10-5-11-19-22-15-7-2-4-9-17(15)25-19/h1-4,6-9H,5,10-13H2,(H,21,23) |
| InChIKey | BBNNBZUPQFOKLV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|