C14H19N3O4S — CID 91838527
N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(methanesulfonamido)propanamide (PubChem CID 91838527) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(methanesulfonamido)propanamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 91838527 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(methanesulfonamido)propanamide |
| SMILES | CS(=O)(=O)NCCC(=O)NCCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H19N3O4S/c1-22(19,20)16-10-8-13(18)15-9-4-7-14-17-11-5-2-3-6-12(11)21-14/h2-3,5-6,16H,4,7-10H2,1H3,(H,15,18) |
| InChIKey | QMPFACPKQQDPNQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|