C17H20N4O2 — CID 118761451
N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(2-methylpyrazol-3-yl)propanamide (PubChem CID 118761451) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(2-methylpyrazol-3-yl)propanamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(2-methylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 118761451 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)propyl]-3-(2-methylpyrazol-3-yl)propanamide |
| SMILES | Cn1nccc1CCC(=O)NCCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C17H20N4O2/c1-21-13(10-12-19-21)8-9-16(22)18-11-4-7-17-20-14-5-2-3-6-15(14)23-17/h2-3,5-6,10,12H,4,7-9,11H2,1H3,(H,18,22) |
| InChIKey | MAKFPUBFKUSOPX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|