C13H15NO3 — CID 18979147
6-(1,3-benzoxazol-2-yl)hexanoic acid (PubChem CID 18979147) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-yl)hexanoic acid.
| Compound Name | 6-(1,3-benzoxazol-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 18979147 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6-(1,3-benzoxazol-2-yl)hexanoic acid |
| SMILES | O=C(O)CCCCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H15NO3/c15-13(16)9-3-1-2-8-12-14-10-6-4-5-7-11(10)17-12/h4-7H,1-3,8-9H2,(H,15,16) |
| InChIKey | YAKPDSOSSGWEMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|