6-(1,3-benzoxazol-2-yl)hexanoic acid

C13H15NO3 — CID 18979147

IUPAC6-(1,3-benzoxazol-2-yl)hexanoic acid
SMILESO=C(O)CCCCCc1nc2ccccc2o1
InChIInChI=1S/C13H15NO3/c15-13(16)9-3-1-2-8-12-14-10-6-4-5-7-11(10)17-12/h4-7H,1-3,8-9H2,(H,15,16)
InChIKeyYAKPDSOSSGWEMD-UHFFFAOYSA-N
MW233.27 g/mol
LogP3.02
Rot. Bonds6

About 6-(1,3-benzoxazol-2-yl)hexanoic acid

6-(1,3-benzoxazol-2-yl)hexanoic acid (PubChem CID 18979147) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-yl)hexanoic acid.

Molecular Properties

Compound Name6-(1,3-benzoxazol-2-yl)hexanoic acid
PubChem CID18979147
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Name6-(1,3-benzoxazol-2-yl)hexanoic acid
SMILESO=C(O)CCCCCc1nc2ccccc2o1
InChIInChI=1S/C13H15NO3/c15-13(16)9-3-1-2-8-12-14-10-6-4-5-7-11(10)17-12/h4-7H,1-3,8-9H2,(H,15,16)
InChIKeyYAKPDSOSSGWEMD-UHFFFAOYSA-N
XLogP3.02
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-(1,3-benzoxazol-2-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(1,3-benzoxazol-2-yl)hexanoic acid?
The IUPAC name of 6-(1,3-benzoxazol-2-yl)hexanoic acid (CID 18979147) is 6-(1,3-benzoxazol-2-yl)hexanoic acid.
What is the SMILES notation for 6-(1,3-benzoxazol-2-yl)hexanoic acid?
The canonical SMILES for 6-(1,3-benzoxazol-2-yl)hexanoic acid is O=C(O)CCCCCc1nc2ccccc2o1.
What is the InChIKey of 6-(1,3-benzoxazol-2-yl)hexanoic acid?
The InChIKey is YAKPDSOSSGWEMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c15-13(16)9-3-1-2-8-12-14-10-6-4-5-7-11(10)17-12/h4-7H,1-3,8-9H2,(H,15,16).
What are the key properties of 6-(1,3-benzoxazol-2-yl)hexanoic acid?
6-(1,3-benzoxazol-2-yl)hexanoic acid has a molecular weight of 233.27 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzoxazol-2-yl)hexanoic acid is sourced from PubChem (CID 18979147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).