C11H10ClNO3 — CID 28930919
4-(5-chloro-1,3-benzoxazol-2-yl)butanoic acid (PubChem CID 28930919) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is 4-(5-chloro-1,3-benzoxazol-2-yl)butanoic acid.
| Compound Name | 4-(5-chloro-1,3-benzoxazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 28930919 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-(5-chloro-1,3-benzoxazol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C11H10ClNO3/c12-7-4-5-9-8(6-7)13-10(16-9)2-1-3-11(14)15/h4-6H,1-3H2,(H,14,15) |
| InChIKey | GZMAFZUDDMYJEC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |