C11H12ClNO — CID 3726019
2-butyl-5-chloro-1,3-benzoxazole (PubChem CID 3726019) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-butyl-5-chloro-1,3-benzoxazole.
| Compound Name | 2-butyl-5-chloro-1,3-benzoxazole |
|---|---|
| PubChem CID | 3726019 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-butyl-5-chloro-1,3-benzoxazole |
| SMILES | CCCCc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C11H12ClNO/c1-2-3-4-11-13-9-7-8(12)5-6-10(9)14-11/h5-7H,2-4H2,1H3 |
| InChIKey | NIFBGGGUYHSOQU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |