C17H17ClN2O — CID 2108047
N-(4-butylphenyl)-5-chloro-1,3-benzoxazol-2-amine (PubChem CID 2108047) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is N-(4-butylphenyl)-5-chloro-1,3-benzoxazol-2-amine.
| Compound Name | N-(4-butylphenyl)-5-chloro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 2108047 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-(4-butylphenyl)-5-chloro-1,3-benzoxazol-2-amine |
| SMILES | CCCCc1ccc(Nc2nc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C17H17ClN2O/c1-2-3-4-12-5-8-14(9-6-12)19-17-20-15-11-13(18)7-10-16(15)21-17/h5-11H,2-4H2,1H3,(H,19,20) |
| InChIKey | MUHHUNJGWAFKOL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |