C11H15N3O — CID 82230351
(5-butyl-1,3-benzoxazol-2-yl)hydrazine (PubChem CID 82230351) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (5-butyl-1,3-benzoxazol-2-yl)hydrazine.
| Compound Name | (5-butyl-1,3-benzoxazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 82230351 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (5-butyl-1,3-benzoxazol-2-yl)hydrazine |
| SMILES | CCCCc1ccc2oc(NN)nc2c1 |
| InChI | InChI=1S/C11H15N3O/c1-2-3-4-8-5-6-10-9(7-8)13-11(14-12)15-10/h5-7H,2-4,12H2,1H3,(H,13,14) |
| InChIKey | NUFJZMYWCHFOCT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|