C21H33N3O — CID 169298595
6-decyl-N-[(3R)-pyrrolidin-3-yl]-1,3-benzoxazol-2-amine (PubChem CID 169298595) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 6-decyl-N-[(3R)-pyrrolidin-3-yl]-1,3-benzoxazol-2-amine.
| Compound Name | 6-decyl-N-[(3R)-pyrrolidin-3-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 169298595 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 6-decyl-N-[(3R)-pyrrolidin-3-yl]-1,3-benzoxazol-2-amine |
| SMILES | CCCCCCCCCCc1ccc2nc(N[C@@H]3CCNC3)oc2c1 |
| InChI | InChI=1S/C21H33N3O/c1-2-3-4-5-6-7-8-9-10-17-11-12-19-20(15-17)25-21(24-19)23-18-13-14-22-16-18/h11-12,15,18,22H,2-10,13-14,16H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | DWYHWUIBROHSHL-GOSISDBHSA-N |
| XLogP | 5.28 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|