C11H13N3O — CID 62381342
N-pyrrolidin-3-yl-1,3-benzoxazol-2-amine (PubChem CID 62381342) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-1,3-benzoxazol-2-amine.
| Compound Name | N-pyrrolidin-3-yl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 62381342 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-pyrrolidin-3-yl-1,3-benzoxazol-2-amine |
| SMILES | c1ccc2oc(NC3CCNC3)nc2c1 |
| InChI | InChI=1S/C11H13N3O/c1-2-4-10-9(3-1)14-11(15-10)13-8-5-6-12-7-8/h1-4,8,12H,5-7H2,(H,13,14) |
| InChIKey | VYQYAZCMWKTVCW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |