C14H18N2O2 — CID 115563724
N-(2,2-dimethyloxan-4-yl)-1,3-benzoxazol-2-amine (PubChem CID 115563724) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 115563724 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-1,3-benzoxazol-2-amine |
| SMILES | CC1(C)CC(Nc2nc3ccccc3o2)CCO1 |
| InChI | InChI=1S/C14H18N2O2/c1-14(2)9-10(7-8-17-14)15-13-16-11-5-3-4-6-12(11)18-13/h3-6,10H,7-9H2,1-2H3,(H,15,16) |
| InChIKey | ZTFYRBJQIJPKQU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |