C15H21N3O — CID 78960182
N-(1H-benzimidazol-2-ylmethyl)-2,2-dimethyloxan-4-amine (PubChem CID 78960182) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2,2-dimethyloxan-4-amine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 78960182 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2,2-dimethyloxan-4-amine |
| SMILES | CC1(C)CC(NCc2nc3ccccc3[nH]2)CCO1 |
| InChI | InChI=1S/C15H21N3O/c1-15(2)9-11(7-8-19-15)16-10-14-17-12-5-3-4-6-13(12)18-14/h3-6,11,16H,7-10H2,1-2H3,(H,17,18) |
| InChIKey | LSDVNNHLNYHQAG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |