C12H19NO2 — CID 753866
(4R)-N-(furan-2-ylmethyl)-2,2-dimethyloxan-4-amine (PubChem CID 753866) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4R)-N-(furan-2-ylmethyl)-2,2-dimethyloxan-4-amine.
| Compound Name | (4R)-N-(furan-2-ylmethyl)-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 753866 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4R)-N-(furan-2-ylmethyl)-2,2-dimethyloxan-4-amine |
| SMILES | CC1(C)C[C@H](NCc2ccco2)CCO1 |
| InChI | InChI=1S/C12H19NO2/c1-12(2)8-10(5-7-15-12)13-9-11-4-3-6-14-11/h3-4,6,10,13H,5,7-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | XRTVEWAIEMXKTN-SNVBAGLBSA-N |
| XLogP | 2.33 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |