C12H17NO3 — CID 115563926
N-(2,2-dimethyloxan-4-yl)furan-2-carboxamide (PubChem CID 115563926) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)furan-2-carboxamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 115563926 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)furan-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2ccco2)CCO1 |
| InChI | InChI=1S/C12H17NO3/c1-12(2)8-9(5-7-16-12)13-11(14)10-4-3-6-15-10/h3-4,6,9H,5,7-8H2,1-2H3,(H,13,14) |
| InChIKey | LLNHFBGPWYQRFB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |