C18H22N2O3 — CID 96544276
N-[(4R)-2,2-dimethyloxan-4-yl]-2-methyl-1-oxoisoquinoline-4-carboxamide (PubChem CID 96544276) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[(4R)-2,2-dimethyloxan-4-yl]-2-methyl-1-oxoisoquinoline-4-carboxamide.
| Compound Name | N-[(4R)-2,2-dimethyloxan-4-yl]-2-methyl-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 96544276 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[(4R)-2,2-dimethyloxan-4-yl]-2-methyl-1-oxoisoquinoline-4-carboxamide |
| SMILES | Cn1cc(C(=O)N[C@@H]2CCOC(C)(C)C2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H22N2O3/c1-18(2)10-12(8-9-23-18)19-16(21)15-11-20(3)17(22)14-7-5-4-6-13(14)15/h4-7,11-12H,8-10H2,1-3H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | RCIQEGZIHZDUPJ-GFCCVEGCSA-N |
| XLogP | 2.23 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |