C15H20ClNO2 — CID 83033483
3-(chloromethyl)-N-(2,2-dimethyloxan-4-yl)benzamide (PubChem CID 83033483) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 3-(chloromethyl)-N-(2,2-dimethyloxan-4-yl)benzamide.
| Compound Name | 3-(chloromethyl)-N-(2,2-dimethyloxan-4-yl)benzamide |
|---|---|
| PubChem CID | 83033483 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(chloromethyl)-N-(2,2-dimethyloxan-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2cccc(CCl)c2)CCO1 |
| InChI | InChI=1S/C15H20ClNO2/c1-15(2)9-13(6-7-19-15)17-14(18)12-5-3-4-11(8-12)10-16/h3-5,8,13H,6-7,9-10H2,1-2H3,(H,17,18) |
| InChIKey | XVAKJCBCRYKJDI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|