C14H19ClN2O2 — CID 113378498
2-chloro-N-(2,2-dimethyloxan-4-yl)-6-methylpyridine-4-carboxamide (PubChem CID 113378498) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethyloxan-4-yl)-6-methylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2,2-dimethyloxan-4-yl)-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 113378498 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-chloro-N-(2,2-dimethyloxan-4-yl)-6-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCOC(C)(C)C2)cc(Cl)n1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-9-6-10(7-12(15)16-9)13(18)17-11-4-5-19-14(2,3)8-11/h6-7,11H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | BNKYVFMUHMOLJJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|