C13H18ClN3O2 — CID 115563972
6-amino-5-chloro-N-(2,2-dimethyloxan-4-yl)pyridine-3-carboxamide (PubChem CID 115563972) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(2,2-dimethyloxan-4-yl)pyridine-3-carboxamide.
| Compound Name | 6-amino-5-chloro-N-(2,2-dimethyloxan-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115563972 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 6-amino-5-chloro-N-(2,2-dimethyloxan-4-yl)pyridine-3-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2cnc(N)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-13(2)6-9(3-4-19-13)17-12(18)8-5-10(14)11(15)16-7-8/h5,7,9H,3-4,6H2,1-2H3,(H2,15,16)(H,17,18) |
| InChIKey | OAWKATAZHLHEMR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |