C16H24N2O2 — CID 83039025
N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzamide (PubChem CID 83039025) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzamide |
|---|---|
| PubChem CID | 83039025 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzamide |
| SMILES | CCNc1ccc(C(=O)NC2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H24N2O2/c1-4-17-13-7-5-12(6-8-13)15(19)18-14-9-10-20-16(2,3)11-14/h5-8,14,17H,4,9-11H2,1-3H3,(H,18,19) |
| InChIKey | DUDBZIMXPQCFBI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |