C15H24N2O3S — CID 83035482
N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzenesulfonamide (PubChem CID 83035482) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzenesulfonamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 83035482 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-4-(ethylamino)benzenesulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)NC2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-4-16-12-5-7-14(8-6-12)21(18,19)17-13-9-10-20-15(2,3)11-13/h5-8,13,16-17H,4,9-11H2,1-3H3 |
| InChIKey | BQDLVBYUQSIEJX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |