C15H23NO4S — CID 83035231
N-(2,2-dimethyloxan-4-yl)-4-(1-hydroxyethyl)benzenesulfonamide (PubChem CID 83035231) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-4-(1-hydroxyethyl)benzenesulfonamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-4-(1-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 83035231 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-4-(1-hydroxyethyl)benzenesulfonamide |
| SMILES | CC(O)c1ccc(S(=O)(=O)NC2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-11(17)12-4-6-14(7-5-12)21(18,19)16-13-8-9-20-15(2,3)10-13/h4-7,11,13,16-17H,8-10H2,1-3H3 |
| InChIKey | NQWGRPWXYORMRW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |