About 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide
2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide (PubChem CID 83028392) has the molecular formula C10H20N2O3S2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide.
Molecular Properties
| Compound Name | 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide |
| PubChem CID | 83028392 |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide |
| SMILES | CC(C(N)=S)S(=O)(=O)NC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C10H20N2O3S2/c1-7(9(11)16)17(13,14)12-8-4-5-15-10(2,3)6-8/h7-8,12H,4-6H2,1-3H3,(H2,11,16) |
| InChIKey | BAPHQRGOVWGIDG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide?
The IUPAC name of 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide (CID 83028392) is 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide.
What is the SMILES notation for 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide?
The canonical SMILES for 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide is CC(C(N)=S)S(=O)(=O)NC1CCOC(C)(C)C1.
What is the InChIKey of 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide?
The InChIKey is BAPHQRGOVWGIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3S2/c1-7(9(11)16)17(13,14)12-8-4-5-15-10(2,3)6-8/h7-8,12H,4-6H2,1-3H3,(H2,11,16).
What are the key properties of 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide?
2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide has a molecular weight of 280.41 g/mol, XLogP of 0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethyloxan-4-yl)sulfamoyl]propanethioamide is sourced from PubChem (CID 83028392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).