C13H26N2O2 — CID 83033230
2-(aminomethyl)-N-(2,2-dimethyloxan-4-yl)-3-methylbutanamide (PubChem CID 83033230) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2,2-dimethyloxan-4-yl)-3-methylbutanamide.
| Compound Name | 2-(aminomethyl)-N-(2,2-dimethyloxan-4-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 83033230 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-(aminomethyl)-N-(2,2-dimethyloxan-4-yl)-3-methylbutanamide |
| SMILES | CC(C)C(CN)C(=O)NC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-9(2)11(8-14)12(16)15-10-5-6-17-13(3,4)7-10/h9-11H,5-8,14H2,1-4H3,(H,15,16) |
| InChIKey | ZHDGCNHUSGIBFP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |