C13H26N2O2 — CID 83033449
(2S)-2-amino-N-(2,2-dimethyloxan-4-yl)-3,3-dimethylbutanamide (PubChem CID 83033449) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-dimethyloxan-4-yl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(2,2-dimethyloxan-4-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 83033449 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (2S)-2-amino-N-(2,2-dimethyloxan-4-yl)-3,3-dimethylbutanamide |
| SMILES | CC1(C)CC(NC(=O)[C@@H](N)C(C)(C)C)CCO1 |
| InChI | InChI=1S/C13H26N2O2/c1-12(2,3)10(14)11(16)15-9-6-7-17-13(4,5)8-9/h9-10H,6-8,14H2,1-5H3,(H,15,16)/t9?,10-/m1/s1 |
| InChIKey | CNAOSOKXEGHIOH-QVDQXJPCSA-N |
| XLogP | 1.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |