C16H29NO4 — CID 116538247
ethyl 2-[(2,2-dimethyloxan-4-yl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 116538247) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl 2-[(2,2-dimethyloxan-4-yl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(2,2-dimethyloxan-4-yl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116538247 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | ethyl 2-[(2,2-dimethyloxan-4-yl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NC1CCOC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C16H29NO4/c1-7-20-14(19)12(15(2,3)4)13(18)17-11-8-9-21-16(5,6)10-11/h11-12H,7-10H2,1-6H3,(H,17,18) |
| InChIKey | CTTYTPCWLRJEBV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|