About 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide
2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide (PubChem CID 83033094) has the molecular formula C11H21N3O3
and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide |
| PubChem CID | 83033094 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide |
| SMILES | CC1(C)CC(NC(=O)C(N)CC(N)=O)CCO1 |
| InChI | InChI=1S/C11H21N3O3/c1-11(2)6-7(3-4-17-11)14-10(16)8(12)5-9(13)15/h7-8H,3-6,12H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | JGUUPGMZMVVGDJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide?
The IUPAC name of 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide (CID 83033094) is 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide.
What is the SMILES notation for 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide?
The canonical SMILES for 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide is CC1(C)CC(NC(=O)C(N)CC(N)=O)CCO1.
What is the InChIKey of 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide?
The InChIKey is JGUUPGMZMVVGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O3/c1-11(2)6-7(3-4-17-11)14-10(16)8(12)5-9(13)15/h7-8H,3-6,12H2,1-2H3,(H2,13,15)(H,14,16).
What are the key properties of 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide?
2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide has a molecular weight of 243.31 g/mol, XLogP of -0.74, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,2-dimethyloxan-4-yl)butanediamide is sourced from PubChem (CID 83033094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).