C13H25N3O3 — CID 83028377
2-amino-N-(2,2-diethyloxan-4-yl)butanediamide (PubChem CID 83028377) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-amino-N-(2,2-diethyloxan-4-yl)butanediamide.
| Compound Name | 2-amino-N-(2,2-diethyloxan-4-yl)butanediamide |
|---|---|
| PubChem CID | 83028377 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-amino-N-(2,2-diethyloxan-4-yl)butanediamide |
| SMILES | CCC1(CC)CC(NC(=O)C(N)CC(N)=O)CCO1 |
| InChI | InChI=1S/C13H25N3O3/c1-3-13(4-2)8-9(5-6-19-13)16-12(18)10(14)7-11(15)17/h9-10H,3-8,14H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | NRSNQVKSPXZDCQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |