C16H32N2O2 — CID 83029071
2-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-4-methylpentanamide (PubChem CID 83029071) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-4-methylpentanamide.
| Compound Name | 2-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 83029071 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 2-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-4-methylpentanamide |
| SMILES | CCC1(CC)CC(NC(=O)C(CN)CC(C)C)CCO1 |
| InChI | InChI=1S/C16H32N2O2/c1-5-16(6-2)10-14(7-8-20-16)18-15(19)13(11-17)9-12(3)4/h12-14H,5-11,17H2,1-4H3,(H,18,19) |
| InChIKey | PTABNJOHONRLCU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |