C12H26N2O3S — CID 83033488
1-amino-N-(2,2-diethyloxan-4-yl)propane-2-sulfonamide (PubChem CID 83033488) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-amino-N-(2,2-diethyloxan-4-yl)propane-2-sulfonamide.
| Compound Name | 1-amino-N-(2,2-diethyloxan-4-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 83033488 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-amino-N-(2,2-diethyloxan-4-yl)propane-2-sulfonamide |
| SMILES | CCC1(CC)CC(NS(=O)(=O)C(C)CN)CCO1 |
| InChI | InChI=1S/C12H26N2O3S/c1-4-12(5-2)8-11(6-7-17-12)14-18(15,16)10(3)9-13/h10-11,14H,4-9,13H2,1-3H3 |
| InChIKey | UZACGJMSQPUHQX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |