C17H34N2O2 — CID 83036657
3-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-5-methylhexanamide (PubChem CID 83036657) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-5-methylhexanamide.
| Compound Name | 3-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-5-methylhexanamide |
|---|---|
| PubChem CID | 83036657 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 3-(aminomethyl)-N-(2,2-diethyloxan-4-yl)-5-methylhexanamide |
| SMILES | CCC1(CC)CC(NC(=O)CC(CN)CC(C)C)CCO1 |
| InChI | InChI=1S/C17H34N2O2/c1-5-17(6-2)11-15(7-8-21-17)19-16(20)10-14(12-18)9-13(3)4/h13-15H,5-12,18H2,1-4H3,(H,19,20) |
| InChIKey | FPHQTHAWAKHFPX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |