C12H26N2O3S — CID 106075173
N-(2,2-dimethyloxan-4-yl)-1-(ethylamino)propane-2-sulfonamide (PubChem CID 106075173) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-1-(ethylamino)propane-2-sulfonamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-1-(ethylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106075173 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-1-(ethylamino)propane-2-sulfonamide |
| SMILES | CCNCC(C)S(=O)(=O)NC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H26N2O3S/c1-5-13-9-10(2)18(15,16)14-11-6-7-17-12(3,4)8-11/h10-11,13-14H,5-9H2,1-4H3 |
| InChIKey | IPSIOMSRGGSLQR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |