C16H34N2O2S — CID 106077363
1-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-2-sulfonamide (PubChem CID 106077363) has the molecular formula C16H34N2O2S and a molecular weight of 318.53 g/mol. Its IUPAC name is 1-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-2-sulfonamide.
| Compound Name | 1-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106077363 |
| Molecular Formula | C16H34N2O2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-2-sulfonamide |
| SMILES | CCCNCC(C)S(=O)(=O)NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H34N2O2S/c1-7-8-17-11-13(2)21(19,20)18-14-9-15(3,4)12-16(5,6)10-14/h13-14,17-18H,7-12H2,1-6H3 |
| InChIKey | ZHPYNZLVOYHOKK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|