C22H46N2O4S2 — CID 20789910
N-[[5-(hexylsulfonylamino)-1,3,3-trimethylcyclohexyl]methyl]hexane-1-sulfonamide (PubChem CID 20789910) has the molecular formula C22H46N2O4S2 and a molecular weight of 466.75 g/mol. Its IUPAC name is N-[[5-(hexylsulfonylamino)-1,3,3-trimethylcyclohexyl]methyl]hexane-1-sulfonamide.
| Compound Name | N-[[5-(hexylsulfonylamino)-1,3,3-trimethylcyclohexyl]methyl]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 20789910 |
| Molecular Formula | C22H46N2O4S2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | N-[[5-(hexylsulfonylamino)-1,3,3-trimethylcyclohexyl]methyl]hexane-1-sulfonamide |
| SMILES | CCCCCCS(=O)(=O)NCC1(C)CC(NS(=O)(=O)CCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C22H46N2O4S2/c1-6-8-10-12-14-29(25,26)23-19-22(5)17-20(16-21(3,4)18-22)24-30(27,28)15-13-11-9-7-2/h20,23-24H,6-19H2,1-5H3 |
| InChIKey | HIKKWNZRZIAGNB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|