C12H26N2O4S2 — CID 57018256
5-cyclohexyl-3-(methanesulfonamido)pentane-1-sulfonamide (PubChem CID 57018256) has the molecular formula C12H26N2O4S2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 5-cyclohexyl-3-(methanesulfonamido)pentane-1-sulfonamide.
| Compound Name | 5-cyclohexyl-3-(methanesulfonamido)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 57018256 |
| Molecular Formula | C12H26N2O4S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-cyclohexyl-3-(methanesulfonamido)pentane-1-sulfonamide |
| SMILES | CS(=O)(=O)NC(CCC1CCCCC1)CCS(N)(=O)=O |
| InChI | InChI=1S/C12H26N2O4S2/c1-19(15,16)14-12(9-10-20(13,17)18)8-7-11-5-3-2-4-6-11/h11-12,14H,2-10H2,1H3,(H2,13,17,18) |
| InChIKey | BCPJGXQSKNXVQR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |