C26H54N2O4S2 — CID 20789883
N-[[1,3,3-trimethyl-5-(octylsulfonylamino)cyclohexyl]methyl]octane-1-sulfonamide (PubChem CID 20789883) has the molecular formula C26H54N2O4S2 and a molecular weight of 522.86 g/mol. Its IUPAC name is N-[[1,3,3-trimethyl-5-(octylsulfonylamino)cyclohexyl]methyl]octane-1-sulfonamide.
| Compound Name | N-[[1,3,3-trimethyl-5-(octylsulfonylamino)cyclohexyl]methyl]octane-1-sulfonamide |
|---|---|
| PubChem CID | 20789883 |
| Molecular Formula | C26H54N2O4S2 |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | N-[[1,3,3-trimethyl-5-(octylsulfonylamino)cyclohexyl]methyl]octane-1-sulfonamide |
| SMILES | CCCCCCCCS(=O)(=O)NCC1(C)CC(NS(=O)(=O)CCCCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C26H54N2O4S2/c1-6-8-10-12-14-16-18-33(29,30)27-23-26(5)21-24(20-25(3,4)22-26)28-34(31,32)19-17-15-13-11-9-7-2/h24,27-28H,6-23H2,1-5H3 |
| InChIKey | OMQQUDAYORLLAN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|