C17H36N2O2S — CID 57222810
5-cyclohexyl-3-(4-methylpentylamino)pentane-1-sulfonamide (PubChem CID 57222810) has the molecular formula C17H36N2O2S and a molecular weight of 332.55 g/mol. Its IUPAC name is 5-cyclohexyl-3-(4-methylpentylamino)pentane-1-sulfonamide.
| Compound Name | 5-cyclohexyl-3-(4-methylpentylamino)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 57222810 |
| Molecular Formula | C17H36N2O2S |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 5-cyclohexyl-3-(4-methylpentylamino)pentane-1-sulfonamide |
| SMILES | CC(C)CCCNC(CCC1CCCCC1)CCS(N)(=O)=O |
| InChI | InChI=1S/C17H36N2O2S/c1-15(2)7-6-13-19-17(12-14-22(18,20)21)11-10-16-8-4-3-5-9-16/h15-17,19H,3-14H2,1-2H3,(H2,18,20,21) |
| InChIKey | NDGGNSSTZPZCBA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|