C15H32N2O3S — CID 106075642
N-(2,2-diethyloxan-4-yl)-4-(ethylamino)butane-1-sulfonamide (PubChem CID 106075642) has the molecular formula C15H32N2O3S and a molecular weight of 320.50 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-4-(ethylamino)butane-1-sulfonamide.
| Compound Name | N-(2,2-diethyloxan-4-yl)-4-(ethylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106075642 |
| Molecular Formula | C15H32N2O3S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-4-(ethylamino)butane-1-sulfonamide |
| SMILES | CCNCCCCS(=O)(=O)NC1CCOC(CC)(CC)C1 |
| InChI | InChI=1S/C15H32N2O3S/c1-4-15(5-2)13-14(9-11-20-15)17-21(18,19)12-8-7-10-16-6-3/h14,16-17H,4-13H2,1-3H3 |
| InChIKey | PGGZNSAAZVSAEJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|