C14H28N2O3S — CID 106075175
4-(cyclopropylamino)-N-(2,2-dimethyloxan-4-yl)butane-1-sulfonamide (PubChem CID 106075175) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(2,2-dimethyloxan-4-yl)butane-1-sulfonamide.
| Compound Name | 4-(cyclopropylamino)-N-(2,2-dimethyloxan-4-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106075175 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-(cyclopropylamino)-N-(2,2-dimethyloxan-4-yl)butane-1-sulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)CCCCNC2CC2)CCO1 |
| InChI | InChI=1S/C14H28N2O3S/c1-14(2)11-13(7-9-19-14)16-20(17,18)10-4-3-8-15-12-5-6-12/h12-13,15-16H,3-11H2,1-2H3 |
| InChIKey | FCTGYWIJUZALCF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|