C11H24N2O2S — CID 114548169
N-(3,3-dimethylcyclopentyl)-2-(ethylamino)ethanesulfonamide (PubChem CID 114548169) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-2-(ethylamino)ethanesulfonamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-2-(ethylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 114548169 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-2-(ethylamino)ethanesulfonamide |
| SMILES | CCNCCS(=O)(=O)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C11H24N2O2S/c1-4-12-7-8-16(14,15)13-10-5-6-11(2,3)9-10/h10,12-13H,4-9H2,1-3H3 |
| InChIKey | YOJOOTGCXXQISK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|