C14H30N2O2S — CID 106077359
3-(methylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-1-sulfonamide (PubChem CID 106077359) has the molecular formula C14H30N2O2S and a molecular weight of 290.47 g/mol. Its IUPAC name is 3-(methylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-1-sulfonamide.
| Compound Name | 3-(methylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106077359 |
| Molecular Formula | C14H30N2O2S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-(methylamino)-N-(3,3,5,5-tetramethylcyclohexyl)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2O2S/c1-13(2)9-12(10-14(3,4)11-13)16-19(17,18)8-6-7-15-5/h12,15-16H,6-11H2,1-5H3 |
| InChIKey | CCMPXSKCDPSPRD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|