2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid

C12H23NO4S — CID 103965500

IUPAC2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid
SMILESCC1(C)CC(NS(=O)(=O)CC(=O)O)CC(C)(C)C1
InChIInChI=1S/C12H23NO4S/c1-11(2)5-9(6-12(3,4)8-11)13-18(16,17)7-10(14)15/h9,13H,5-8H2,1-4H3,(H,14,15)
InChIKeyMXIZSMQHJJOSGF-UHFFFAOYSA-N
MW277.39 g/mol
LogP1.60
Rot. Bonds4

About 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid

2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid (PubChem CID 103965500) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid.

Molecular Properties

Compound Name2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid
PubChem CID103965500
Molecular FormulaC12H23NO4S
Molecular Weight277.39 g/mol
Exact Mass277.13
IUPAC Name2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid
SMILESCC1(C)CC(NS(=O)(=O)CC(=O)O)CC(C)(C)C1
InChIInChI=1S/C12H23NO4S/c1-11(2)5-9(6-12(3,4)8-11)13-18(16,17)7-10(14)15/h9,13H,5-8H2,1-4H3,(H,14,15)
InChIKeyMXIZSMQHJJOSGF-UHFFFAOYSA-N
XLogP1.60
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.39
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid?
The IUPAC name of 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid (CID 103965500) is 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid.
What is the SMILES notation for 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid?
The canonical SMILES for 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid is CC1(C)CC(NS(=O)(=O)CC(=O)O)CC(C)(C)C1.
What is the InChIKey of 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid?
The InChIKey is MXIZSMQHJJOSGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4S/c1-11(2)5-9(6-12(3,4)8-11)13-18(16,17)7-10(14)15/h9,13H,5-8H2,1-4H3,(H,14,15).
What are the key properties of 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid?
2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid has a molecular weight of 277.39 g/mol, XLogP of 1.60, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]acetic acid is sourced from PubChem (CID 103965500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).